C7H14O5S — CID 144721467
(2S,5R)-2-methoxy-6-(sulfanylmethyl)oxane-3,4,5-triol (PubChem CID 144721467) has the molecular formula C7H14O5S and a molecular weight of 210.25 g/mol. Its IUPAC name is (2S,5R)-2-methoxy-6-(sulfanylmethyl)oxane-3,4,5-triol.
| Compound Name | (2S,5R)-2-methoxy-6-(sulfanylmethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 144721467 |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (2S,5R)-2-methoxy-6-(sulfanylmethyl)oxane-3,4,5-triol |
| SMILES | CO[C@H]1OC(CS)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C7H14O5S/c1-11-7-6(10)5(9)4(8)3(2-13)12-7/h3-10,13H,2H2,1H3/t3?,4-,5?,6?,7-/m0/s1 |
| InChIKey | XDEBRRDIMCXBPG-JOVCDLOVSA-N |
| XLogP | -1.63 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|