C12H22O9S2 — CID 163757656
(3S,6S)-2-(sulfanylmethyl)-6-[(2S,5S)-3,4,5-trihydroxy-6-(sulfanylmethyl)oxan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 163757656) has the molecular formula C12H22O9S2 and a molecular weight of 374.43 g/mol. Its IUPAC name is (3S,6S)-2-(sulfanylmethyl)-6-[(2S,5S)-3,4,5-trihydroxy-6-(sulfanylmethyl)oxan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (3S,6S)-2-(sulfanylmethyl)-6-[(2S,5S)-3,4,5-trihydroxy-6-(sulfanylmethyl)oxan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 163757656 |
| Molecular Formula | C12H22O9S2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (3S,6S)-2-(sulfanylmethyl)-6-[(2S,5S)-3,4,5-trihydroxy-6-(sulfanylmethyl)oxan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | OC1C(O)[C@H](O)C(CS)O[C@H]1O[C@@H]1OC(CS)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C12H22O9S2/c13-5-3(1-22)19-11(9(17)7(5)15)21-12-10(18)8(16)6(14)4(2-23)20-12/h3-18,22-23H,1-2H2/t3?,4?,5-,6-,7?,8?,9?,10?,11+,12+/m1/s1 |
| InChIKey | LVLYFBOCRJBHIZ-MIZFXOTFSA-N |
| XLogP | -3.52 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|