C13H22O14S2-2 — CID 59736167
[(2S,3R,4S,5R)-4-hydroxy-2-[(3S,4S,5S)-5-hydroxy-6-methoxy-2-methyl-4-sulfonatooxyoxan-3-yl]oxy-5-methyloxan-3-yl] sulfate (PubChem CID 59736167) has the molecular formula C13H22O14S2-2 and a molecular weight of 466.44 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-4-hydroxy-2-[(3S,4S,5S)-5-hydroxy-6-methoxy-2-methyl-4-sulfonatooxyoxan-3-yl]oxy-5-methyloxan-3-yl] sulfate.
| Compound Name | [(2S,3R,4S,5R)-4-hydroxy-2-[(3S,4S,5S)-5-hydroxy-6-methoxy-2-methyl-4-sulfonatooxyoxan-3-yl]oxy-5-methyloxan-3-yl] sulfate |
|---|---|
| PubChem CID | 59736167 |
| Molecular Formula | C13H22O14S2-2 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | [(2S,3R,4S,5R)-4-hydroxy-2-[(3S,4S,5S)-5-hydroxy-6-methoxy-2-methyl-4-sulfonatooxyoxan-3-yl]oxy-5-methyloxan-3-yl] sulfate |
| SMILES | COC1OC(C)[C@H](O[C@@H]2OC[C@@H](C)[C@H](O)[C@H]2OS(=O)(=O)[O-])[C@@H](OS(=O)(=O)[O-])[C@@H]1O |
| InChI | InChI=1S/C13H24O14S2/c1-5-4-23-13(11(7(5)14)27-29(19,20)21)25-9-6(2)24-12(22-3)8(15)10(9)26-28(16,17)18/h5-15H,4H2,1-3H3,(H,16,17,18)(H,19,20,21)/p-2/t5-,6?,7+,8+,9+,10+,11-,12?,13+/m1/s1 |
| InChIKey | JATIQNBCBVVDHQ-TWNXBYBVSA-L |
| XLogP | -2.83 |
| TPSA | 210.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|