2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate

C11H22N2S2 — CID 174636452

IUPAC2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate
SMILESCCN(CC)C(=S)SCCN1CCCC1
InChIInChI=1S/C11H22N2S2/c1-3-13(4-2)11(14)15-10-9-12-7-5-6-8-12/h3-10H2,1-2H3
InChIKeyRCNTURBSORAURZ-UHFFFAOYSA-N
MW246.44 g/mol
LogP2.44
Rot. Bonds5

About 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate

2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate (PubChem CID 174636452) has the molecular formula C11H22N2S2 and a molecular weight of 246.44 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate.

Molecular Properties

Compound Name2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate
PubChem CID174636452
Molecular FormulaC11H22N2S2
Molecular Weight246.44 g/mol
Exact Mass246.12
IUPAC Name2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate
SMILESCCN(CC)C(=S)SCCN1CCCC1
InChIInChI=1S/C11H22N2S2/c1-3-13(4-2)11(14)15-10-9-12-7-5-6-8-12/h3-10H2,1-2H3
InChIKeyRCNTURBSORAURZ-UHFFFAOYSA-N
XLogP2.44
TPSA6.48 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.44
LogP ≤ 52.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate?
The IUPAC name of 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate (CID 174636452) is 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate.
What is the SMILES notation for 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate?
The canonical SMILES for 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate is CCN(CC)C(=S)SCCN1CCCC1.
What is the InChIKey of 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate?
The InChIKey is RCNTURBSORAURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S2/c1-3-13(4-2)11(14)15-10-9-12-7-5-6-8-12/h3-10H2,1-2H3.
What are the key properties of 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate?
2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate has a molecular weight of 246.44 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate is sourced from PubChem (CID 174636452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).