C11H22N2S2 — CID 174636452
2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate (PubChem CID 174636452) has the molecular formula C11H22N2S2 and a molecular weight of 246.44 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate.
| Compound Name | 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 174636452 |
| Molecular Formula | C11H22N2S2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCCN1CCCC1 |
| InChI | InChI=1S/C11H22N2S2/c1-3-13(4-2)11(14)15-10-9-12-7-5-6-8-12/h3-10H2,1-2H3 |
| InChIKey | RCNTURBSORAURZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|