C12H21F2NS2 — CID 23020186
[(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate (PubChem CID 23020186) has the molecular formula C12H21F2NS2 and a molecular weight of 281.44 g/mol. Its IUPAC name is [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate.
| Compound Name | [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 23020186 |
| Molecular Formula | C12H21F2NS2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC/C=C/C(C)C(F)F |
| InChI | InChI=1S/C12H21F2NS2/c1-4-15(5-2)12(16)17-9-7-6-8-10(3)11(13)14/h6,8,10-11H,4-5,7,9H2,1-3H3/b8-6+ |
| InChIKey | MMDUHNLQXFANFN-SOFGYWHQSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|