About [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate
[(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate (PubChem CID 23020186) has the molecular formula C12H21F2NS2
and a molecular weight of 281.44 g/mol. Its IUPAC name is [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate |
| PubChem CID | 23020186 |
| Molecular Formula | C12H21F2NS2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC/C=C/C(C)C(F)F |
| InChI | InChI=1S/C12H21F2NS2/c1-4-15(5-2)12(16)17-9-7-6-8-10(3)11(13)14/h6,8,10-11H,4-5,7,9H2,1-3H3/b8-6+ |
| InChIKey | MMDUHNLQXFANFN-SOFGYWHQSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate?
The IUPAC name of [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate (CID 23020186) is [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate.
What is the SMILES notation for [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate?
The canonical SMILES for [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate is CCN(CC)C(=S)SCC/C=C/C(C)C(F)F.
What is the InChIKey of [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate?
The InChIKey is MMDUHNLQXFANFN-SOFGYWHQSA-N. The full InChI is InChI=1S/C12H21F2NS2/c1-4-15(5-2)12(16)17-9-7-6-8-10(3)11(13)14/h6,8,10-11H,4-5,7,9H2,1-3H3/b8-6+.
What are the key properties of [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate?
[(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate has a molecular weight of 281.44 g/mol, XLogP of 4.19, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6,6-difluoro-5-methylhex-3-enyl] N,N-diethylcarbamodithioate is sourced from PubChem (CID 23020186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).