C12H21F2NOS — CID 173145927
O-(6,6-difluoro-5-methylhex-3-enyl) N,N-diethylcarbamothioate (PubChem CID 173145927) has the molecular formula C12H21F2NOS and a molecular weight of 265.37 g/mol. Its IUPAC name is O-(6,6-difluoro-5-methylhex-3-enyl) N,N-diethylcarbamothioate.
| Compound Name | O-(6,6-difluoro-5-methylhex-3-enyl) N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 173145927 |
| Molecular Formula | C12H21F2NOS |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | O-(6,6-difluoro-5-methylhex-3-enyl) N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=S)OCCC=CC(C)C(F)F |
| InChI | InChI=1S/C12H21F2NOS/c1-4-15(5-2)12(17)16-9-7-6-8-10(3)11(13)14/h6,8,10-11H,4-5,7,9H2,1-3H3 |
| InChIKey | QVDAXCUNKHHLSL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|