C18H28N2O2S2 — CID 88619040
O-[[4-(diethylcarbamothioyloxymethyl)phenyl]methyl] N,N-diethylcarbamothioate (PubChem CID 88619040) has the molecular formula C18H28N2O2S2 and a molecular weight of 368.57 g/mol. Its IUPAC name is O-[[4-(diethylcarbamothioyloxymethyl)phenyl]methyl] N,N-diethylcarbamothioate.
| Compound Name | O-[[4-(diethylcarbamothioyloxymethyl)phenyl]methyl] N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 88619040 |
| Molecular Formula | C18H28N2O2S2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | O-[[4-(diethylcarbamothioyloxymethyl)phenyl]methyl] N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=S)OCc1ccc(COC(=S)N(CC)CC)cc1 |
| InChI | InChI=1S/C18H28N2O2S2/c1-5-19(6-2)17(23)21-13-15-9-11-16(12-10-15)14-22-18(24)20(7-3)8-4/h9-12H,5-8,13-14H2,1-4H3 |
| InChIKey | JUGPYADRVCFWSX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|