C16H23NO2S — CID 88805770
O-(2-benzyl-3-oxobutyl) N,N-diethylcarbamothioate (PubChem CID 88805770) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is O-(2-benzyl-3-oxobutyl) N,N-diethylcarbamothioate.
| Compound Name | O-(2-benzyl-3-oxobutyl) N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 88805770 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | O-(2-benzyl-3-oxobutyl) N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=S)OCC(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C16H23NO2S/c1-4-17(5-2)16(20)19-12-15(13(3)18)11-14-9-7-6-8-10-14/h6-10,15H,4-5,11-12H2,1-3H3 |
| InChIKey | LMOWWBTVBPAOTN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|