C18H28N2O4S2 — CID 88806820
carbamothioic S-acid;O-[2-[(4-methoxyphenyl)methyl]-3-oxobutyl] N,N-diethylcarbamothioate (PubChem CID 88806820) has the molecular formula C18H28N2O4S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is carbamothioic S-acid;O-[2-[(4-methoxyphenyl)methyl]-3-oxobutyl] N,N-diethylcarbamothioate.
| Compound Name | carbamothioic S-acid;O-[2-[(4-methoxyphenyl)methyl]-3-oxobutyl] N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 88806820 |
| Molecular Formula | C18H28N2O4S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | carbamothioic S-acid;O-[2-[(4-methoxyphenyl)methyl]-3-oxobutyl] N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=S)OCC(Cc1ccc(OC)cc1)C(C)=O.NC(=O)S |
| InChI | InChI=1S/C17H25NO3S.CH3NOS/c1-5-18(6-2)17(22)21-12-15(13(3)19)11-14-7-9-16(20-4)10-8-14;2-1(3)4/h7-10,15H,5-6,11-12H2,1-4H3;(H3,2,3,4) |
| InChIKey | PJNPWCVDNOZDNU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|