C31H29NO4 — CID 59801354
[4-[4-(acetyloxymethyl)-N-[4-(4-methylphenyl)phenyl]anilino]phenyl]methyl acetate (PubChem CID 59801354) has the molecular formula C31H29NO4 and a molecular weight of 479.58 g/mol. Its IUPAC name is [4-[4-(acetyloxymethyl)-N-[4-(4-methylphenyl)phenyl]anilino]phenyl]methyl acetate.
| Compound Name | [4-[4-(acetyloxymethyl)-N-[4-(4-methylphenyl)phenyl]anilino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 59801354 |
| Molecular Formula | C31H29NO4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [4-[4-(acetyloxymethyl)-N-[4-(4-methylphenyl)phenyl]anilino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(N(c2ccc(COC(C)=O)cc2)c2ccc(-c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H29NO4/c1-22-4-10-27(11-5-22)28-12-18-31(19-13-28)32(29-14-6-25(7-15-29)20-35-23(2)33)30-16-8-26(9-17-30)21-36-24(3)34/h4-19H,20-21H2,1-3H3 |
| InChIKey | XXFFKOHZYFHQBU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |