C52H60N2O4 — CID 68881964
6-[[4-(N-[4-[4-(N-[4-(6-hydroxyhexoxymethyl)phenyl]-4-methylanilino)phenyl]phenyl]-4-methylanilino)phenyl]methoxy]hexan-1-ol (PubChem CID 68881964) has the molecular formula C52H60N2O4 and a molecular weight of 777.06 g/mol. Its IUPAC name is 6-[[4-(N-[4-[4-(N-[4-(6-hydroxyhexoxymethyl)phenyl]-4-methylanilino)phenyl]phenyl]-4-methylanilino)phenyl]methoxy]hexan-1-ol.
| Compound Name | 6-[[4-(N-[4-[4-(N-[4-(6-hydroxyhexoxymethyl)phenyl]-4-methylanilino)phenyl]phenyl]-4-methylanilino)phenyl]methoxy]hexan-1-ol |
|---|---|
| PubChem CID | 68881964 |
| Molecular Formula | C52H60N2O4 |
| Molecular Weight | 777.06 g/mol |
| Exact Mass | 776.46 |
| IUPAC Name | 6-[[4-(N-[4-[4-(N-[4-(6-hydroxyhexoxymethyl)phenyl]-4-methylanilino)phenyl]phenyl]-4-methylanilino)phenyl]methoxy]hexan-1-ol |
| SMILES | Cc1ccc(N(c2ccc(COCCCCCCO)cc2)c2ccc(-c3ccc(N(c4ccc(C)cc4)c4ccc(COCCCCCCO)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H60N2O4/c1-41-11-23-47(24-12-41)53(49-27-15-43(16-28-49)39-57-37-9-5-3-7-35-55)51-31-19-45(20-32-51)46-21-33-52(34-22-46)54(48-25-13-42(2)14-26-48)50-29-17-44(18-30-50)40-58-38-10-6-4-8-36-56/h11-34,55-56H,3-10,35-40H2,1-2H3 |
| InChIKey | DPJPWXMSKIUGBR-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.06 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|