C30H31NO — CID 67358855
4-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]butan-1-ol (PubChem CID 67358855) has the molecular formula C30H31NO and a molecular weight of 421.58 g/mol. Its IUPAC name is 4-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]butan-1-ol.
| Compound Name | 4-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 67358855 |
| Molecular Formula | C30H31NO |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]butan-1-ol |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc(CCCCO)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H31NO/c1-23-6-16-28(17-7-23)31(29-18-8-24(2)9-19-29)30-20-14-27(15-21-30)26-12-10-25(11-13-26)5-3-4-22-32/h6-21,32H,3-5,22H2,1-2H3 |
| InChIKey | XEAUYSZMILZAIP-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|