About carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate
carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate (PubChem CID 88834401) has the molecular formula C17H27FN2O2S2
and a molecular weight of 374.55 g/mol. Its IUPAC name is carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate.
Molecular Properties
| Compound Name | carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate |
| PubChem CID | 88834401 |
| Molecular Formula | C17H27FN2O2S2 |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate |
| SMILES | CCC(C)N(C(=S)OCc1ccc(F)cc1)C(C)CC.NC(=O)S |
| InChI | InChI=1S/C16H24FNOS.CH3NOS/c1-5-12(3)18(13(4)6-2)16(20)19-11-14-7-9-15(17)10-8-14;2-1(3)4/h7-10,12-13H,5-6,11H2,1-4H3;(H3,2,3,4) |
| InChIKey | MUKGFVXOZZKSQX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate?
The IUPAC name of carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate (CID 88834401) is carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate.
What is the SMILES notation for carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate?
The canonical SMILES for carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate is CCC(C)N(C(=S)OCc1ccc(F)cc1)C(C)CC.NC(=O)S.
What is the InChIKey of carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate?
The InChIKey is MUKGFVXOZZKSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24FNOS.CH3NOS/c1-5-12(3)18(13(4)6-2)16(20)19-11-14-7-9-15(17)10-8-14;2-1(3)4/h7-10,12-13H,5-6,11H2,1-4H3;(H3,2,3,4).
What are the key properties of carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate?
carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate has a molecular weight of 374.55 g/mol, XLogP of 4.52, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;O-[(4-fluorophenyl)methyl] N,N-di(butan-2-yl)carbamothioate is sourced from PubChem (CID 88834401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).