C18H20FNO3S2 — CID 88744731
[4-(4-fluorophenoxy)phenyl]methyl N,N-bis(1-sulfanylethyl)carbamate (PubChem CID 88744731) has the molecular formula C18H20FNO3S2 and a molecular weight of 381.49 g/mol. Its IUPAC name is [4-(4-fluorophenoxy)phenyl]methyl N,N-bis(1-sulfanylethyl)carbamate.
| Compound Name | [4-(4-fluorophenoxy)phenyl]methyl N,N-bis(1-sulfanylethyl)carbamate |
|---|---|
| PubChem CID | 88744731 |
| Molecular Formula | C18H20FNO3S2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [4-(4-fluorophenoxy)phenyl]methyl N,N-bis(1-sulfanylethyl)carbamate |
| SMILES | CC(S)N(C(=O)OCc1ccc(Oc2ccc(F)cc2)cc1)C(C)S |
| InChI | InChI=1S/C18H20FNO3S2/c1-12(24)20(13(2)25)18(21)22-11-14-3-7-16(8-4-14)23-17-9-5-15(19)6-10-17/h3-10,12-13,24-25H,11H2,1-2H3 |
| InChIKey | YDEVBSLKBQCBCB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|