C16H21NO2S3 — CID 57208161
(4-ethylsulfanylphenyl)methyl N,N-bis(1-sulfanylprop-2-enyl)carbamate (PubChem CID 57208161) has the molecular formula C16H21NO2S3 and a molecular weight of 355.55 g/mol. Its IUPAC name is (4-ethylsulfanylphenyl)methyl N,N-bis(1-sulfanylprop-2-enyl)carbamate.
| Compound Name | (4-ethylsulfanylphenyl)methyl N,N-bis(1-sulfanylprop-2-enyl)carbamate |
|---|---|
| PubChem CID | 57208161 |
| Molecular Formula | C16H21NO2S3 |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (4-ethylsulfanylphenyl)methyl N,N-bis(1-sulfanylprop-2-enyl)carbamate |
| SMILES | C=CC(S)N(C(=O)OCc1ccc(SCC)cc1)C(S)C=C |
| InChI | InChI=1S/C16H21NO2S3/c1-4-14(20)17(15(21)5-2)16(18)19-11-12-7-9-13(10-8-12)22-6-3/h4-5,7-10,14-15,20-21H,1-2,6,11H2,3H3 |
| InChIKey | QSOWNFGMKIVAJH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|