C11H16N2O3S2 — CID 88694362
O-benzyl N-(1-hydroxyethyl)carbamothioate;carbamothioic S-acid (PubChem CID 88694362) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is O-benzyl N-(1-hydroxyethyl)carbamothioate;carbamothioic S-acid.
| Compound Name | O-benzyl N-(1-hydroxyethyl)carbamothioate;carbamothioic S-acid |
|---|---|
| PubChem CID | 88694362 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | O-benzyl N-(1-hydroxyethyl)carbamothioate;carbamothioic S-acid |
| SMILES | CC(O)NC(=S)OCc1ccccc1.NC(=O)S |
| InChI | InChI=1S/C10H13NO2S.CH3NOS/c1-8(12)11-10(14)13-7-9-5-3-2-4-6-9;2-1(3)4/h2-6,8,12H,7H2,1H3,(H,11,14);(H3,2,3,4) |
| InChIKey | LCFVCGHLXZRIEO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|