C10H21NO5S — CID 102061956
O-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl] N,N-diethylcarbamothioate (PubChem CID 102061956) has the molecular formula C10H21NO5S and a molecular weight of 267.35 g/mol. Its IUPAC name is O-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl] N,N-diethylcarbamothioate.
| Compound Name | O-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl] N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 102061956 |
| Molecular Formula | C10H21NO5S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | O-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl] N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=S)OC[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H21NO5S/c1-3-11(4-2)10(17)16-6-8(14)9(15)7(13)5-12/h7-9,12-15H,3-6H2,1-2H3/t7-,8+,9+/m0/s1 |
| InChIKey | RJCFGDJQHSNODC-DJLDLDEBSA-N |
| XLogP | -1.30 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|