C10H16Cl3NS2 — CID 5385983
[(Z)-5,5,5-trichloropent-2-enyl] N,N-diethylcarbamodithioate (PubChem CID 5385983) has the molecular formula C10H16Cl3NS2 and a molecular weight of 320.74 g/mol. Its IUPAC name is [(Z)-5,5,5-trichloropent-2-enyl] N,N-diethylcarbamodithioate.
| Compound Name | [(Z)-5,5,5-trichloropent-2-enyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 5385983 |
| Molecular Formula | C10H16Cl3NS2 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | [(Z)-5,5,5-trichloropent-2-enyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC/C=C\CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H16Cl3NS2/c1-3-14(4-2)9(15)16-8-6-5-7-10(11,12)13/h5-6H,3-4,7-8H2,1-2H3/b6-5- |
| InChIKey | XPUHWBLVEZBGOF-WAYWQWQTSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|