C15H21Cl3N2O2S2 — CID 88720175
carbamothioic S-acid;propane;O-(2,3,3-trichloroprop-2-enyl) N-benzylcarbamothioate (PubChem CID 88720175) has the molecular formula C15H21Cl3N2O2S2 and a molecular weight of 431.84 g/mol. Its IUPAC name is carbamothioic S-acid;propane;O-(2,3,3-trichloroprop-2-enyl) N-benzylcarbamothioate.
| Compound Name | carbamothioic S-acid;propane;O-(2,3,3-trichloroprop-2-enyl) N-benzylcarbamothioate |
|---|---|
| PubChem CID | 88720175 |
| Molecular Formula | C15H21Cl3N2O2S2 |
| Molecular Weight | 431.84 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | carbamothioic S-acid;propane;O-(2,3,3-trichloroprop-2-enyl) N-benzylcarbamothioate |
| SMILES | CCC.NC(=O)S.S=C(NCc1ccccc1)OCC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3NOS.C3H8.CH3NOS/c12-9(10(13)14)7-16-11(17)15-6-8-4-2-1-3-5-8;1-3-2;2-1(3)4/h1-5H,6-7H2,(H,15,17);3H2,1-2H3;(H3,2,3,4) |
| InChIKey | KZODVJIASKPFRE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|