C13H15Cl3N2O2S2 — CID 88716555
carbamothioic S-acid;O-(2,3,3-trichloroprop-2-enyl) N-(1-phenylethyl)carbamothioate (PubChem CID 88716555) has the molecular formula C13H15Cl3N2O2S2 and a molecular weight of 401.77 g/mol. Its IUPAC name is carbamothioic S-acid;O-(2,3,3-trichloroprop-2-enyl) N-(1-phenylethyl)carbamothioate.
| Compound Name | carbamothioic S-acid;O-(2,3,3-trichloroprop-2-enyl) N-(1-phenylethyl)carbamothioate |
|---|---|
| PubChem CID | 88716555 |
| Molecular Formula | C13H15Cl3N2O2S2 |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | carbamothioic S-acid;O-(2,3,3-trichloroprop-2-enyl) N-(1-phenylethyl)carbamothioate |
| SMILES | CC(NC(=S)OCC(Cl)=C(Cl)Cl)c1ccccc1.NC(=O)S |
| InChI | InChI=1S/C12H12Cl3NOS.CH3NOS/c1-8(9-5-3-2-4-6-9)16-12(18)17-7-10(13)11(14)15;2-1(3)4/h2-6,8H,7H2,1H3,(H,16,18);(H3,2,3,4) |
| InChIKey | DEHQYGUYUGZISX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|