C15H17BrN2O3S2 — CID 71444425
benzylthiourea;5-bromo-2-methylbenzenesulfonic acid (PubChem CID 71444425) has the molecular formula C15H17BrN2O3S2 and a molecular weight of 417.35 g/mol. Its IUPAC name is benzylthiourea;5-bromo-2-methylbenzenesulfonic acid.
| Compound Name | benzylthiourea;5-bromo-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 71444425 |
| Molecular Formula | C15H17BrN2O3S2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | benzylthiourea;5-bromo-2-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)O.NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C8H10N2S.C7H7BrO3S/c9-8(11)10-6-7-4-2-1-3-5-7;1-5-2-3-6(8)4-7(5)12(9,10)11/h1-5H,6H2,(H3,9,10,11);2-4H,1H3,(H,9,10,11) |
| InChIKey | MDHYEWOXXQYFSF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|