C16H18BrNO2S — CID 61068907
5-bromo-N,2-dimethyl-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 61068907) has the molecular formula C16H18BrNO2S and a molecular weight of 368.30 g/mol. Its IUPAC name is 5-bromo-N,2-dimethyl-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 5-bromo-N,2-dimethyl-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61068907 |
| Molecular Formula | C16H18BrNO2S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 5-bromo-N,2-dimethyl-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)N(C)CCc1ccccc1 |
| InChI | InChI=1S/C16H18BrNO2S/c1-13-8-9-15(17)12-16(13)21(19,20)18(2)11-10-14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | UMIQJESRUFDPLK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |