C15H15BrClNO2S — CID 61066587
4-bromo-2-chloro-N-methyl-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 61066587) has the molecular formula C15H15BrClNO2S and a molecular weight of 388.71 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-methyl-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-methyl-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61066587 |
| Molecular Formula | C15H15BrClNO2S |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 4-bromo-2-chloro-N-methyl-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | CN(CCc1ccccc1)S(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H15BrClNO2S/c1-18(10-9-12-5-3-2-4-6-12)21(19,20)15-8-7-13(16)11-14(15)17/h2-8,11H,9-10H2,1H3 |
| InChIKey | YIHAORCLZBQMSF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |