C16H12N4S5 — CID 13071639
[5-(phenylcarbamothioylsulfanyl)-1,3,4-thiadiazol-2-yl] N-phenylcarbamodithioate (PubChem CID 13071639) has the molecular formula C16H12N4S5 and a molecular weight of 420.64 g/mol. Its IUPAC name is [5-(phenylcarbamothioylsulfanyl)-1,3,4-thiadiazol-2-yl] N-phenylcarbamodithioate.
| Compound Name | [5-(phenylcarbamothioylsulfanyl)-1,3,4-thiadiazol-2-yl] N-phenylcarbamodithioate |
|---|---|
| PubChem CID | 13071639 |
| Molecular Formula | C16H12N4S5 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | [5-(phenylcarbamothioylsulfanyl)-1,3,4-thiadiazol-2-yl] N-phenylcarbamodithioate |
| SMILES | S=C(Nc1ccccc1)Sc1nnc(SC(=S)Nc2ccccc2)s1 |
| InChI | InChI=1S/C16H12N4S5/c21-13(17-11-7-3-1-4-8-11)23-15-19-20-16(25-15)24-14(22)18-12-9-5-2-6-10-12/h1-10H,(H,17,21)(H,18,22) |
| InChIKey | LGEALEXFHRSFIV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|