C23H19N3O2S2 — CID 4642499
[3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl] N,N'-diphenylcarbamimidothioate (PubChem CID 4642499) has the molecular formula C23H19N3O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is [3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl] N,N'-diphenylcarbamimidothioate.
| Compound Name | [3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl] N,N'-diphenylcarbamimidothioate |
|---|---|
| PubChem CID | 4642499 |
| Molecular Formula | C23H19N3O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | [3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl] N,N'-diphenylcarbamimidothioate |
| SMILES | Cc1ccc(N2C(=O)SC(S/C(=N/c3ccccc3)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H19N3O2S2/c1-16-12-14-19(15-13-16)26-20(27)21(30-23(26)28)29-22(24-17-8-4-2-5-9-17)25-18-10-6-3-7-11-18/h2-15,21H,1H3,(H,24,25) |
| InChIKey | ASEJRRBSOKJNQR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|