C24H22N4O2S — CID 99129880
1-[3-[[(3R)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]phenyl]-3-phenylthiourea (PubChem CID 99129880) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-[3-[[(3R)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]phenyl]-3-phenylthiourea.
| Compound Name | 1-[3-[[(3R)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]phenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 99129880 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-[3-[[(3R)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]phenyl]-3-phenylthiourea |
| SMILES | Cc1ccc(N2C(=O)C[C@@H](Nc3cccc(NC(=S)Nc4ccccc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H22N4O2S/c1-16-10-12-20(13-11-16)28-22(29)15-21(23(28)30)25-18-8-5-9-19(14-18)27-24(31)26-17-6-3-2-4-7-17/h2-14,21,25H,15H2,1H3,(H2,26,27,31)/t21-/m1/s1 |
| InChIKey | WJGXPCBXJOSZGV-OAQYLSRUSA-N |
| XLogP | 4.55 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|