About (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide
(Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide (PubChem CID 137183212) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide |
| PubChem CID | 137183212 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide |
| SMILES | CC(=O)C(/C(N)=N/c1ccccc1)=C(/C)O |
| InChI | InChI=1S/C12H14N2O2/c1-8(15)11(9(2)16)12(13)14-10-6-4-3-5-7-10/h3-7,15H,1-2H3,(H2,13,14)/b11-8+ |
| InChIKey | BPDDBDCEULJYIE-DHZHZOJOSA-N |
| XLogP | 2.10 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide?
The IUPAC name of (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide (CID 137183212) is (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide.
What is the SMILES notation for (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide?
The canonical SMILES for (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide is CC(=O)C(/C(N)=N/c1ccccc1)=C(/C)O.
What is the InChIKey of (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide?
The InChIKey is BPDDBDCEULJYIE-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-8(15)11(9(2)16)12(13)14-10-6-4-3-5-7-10/h3-7,15H,1-2H3,(H2,13,14)/b11-8+.
What are the key properties of (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide?
(Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide has a molecular weight of 218.26 g/mol, XLogP of 2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-acetyl-3-hydroxy-N'-phenylbut-2-enimidamide is sourced from PubChem (CID 137183212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).