About N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide
N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide (PubChem CID 134928433) has the molecular formula C20H18N2S
and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide.
Molecular Properties
| Compound Name | N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide |
| PubChem CID | 134928433 |
| Molecular Formula | C20H18N2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide |
| SMILES | C/C(N=S(c1ccccc1)c1ccccc1)=N\c1ccccc1 |
| InChI | InChI=1S/C20H18N2S/c1-17(21-18-11-5-2-6-12-18)22-23(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3/b21-17+ |
| InChIKey | IILYDVQFOGASOK-HEHNFIMWSA-N |
| XLogP | 5.66 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide?
The IUPAC name of N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide (CID 134928433) is N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide.
What is the SMILES notation for N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide?
The canonical SMILES for N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide is C/C(N=S(c1ccccc1)c1ccccc1)=N\c1ccccc1.
What is the InChIKey of N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide?
The InChIKey is IILYDVQFOGASOK-HEHNFIMWSA-N. The full InChI is InChI=1S/C20H18N2S/c1-17(21-18-11-5-2-6-12-18)22-23(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3/b21-17+.
What are the key properties of N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide?
N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide has a molecular weight of 318.44 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diphenyl-λ4-sulfanylidene)-N'-phenylethanimidamide is sourced from PubChem (CID 134928433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).