About N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide
N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide (PubChem CID 134928838) has the molecular formula C27H24N2S
and a molecular weight of 408.57 g/mol. Its IUPAC name is N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide.
Molecular Properties
| Compound Name | N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide |
| PubChem CID | 134928838 |
| Molecular Formula | C27H24N2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide |
| SMILES | Cc1ccccc1/N=C(\Cc1ccccc1)N=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24N2S/c1-22-13-11-12-20-26(22)28-27(21-23-14-5-2-6-15-23)29-30(24-16-7-3-8-17-24)25-18-9-4-10-19-25/h2-20H,21H2,1H3/b28-27+ |
| InChIKey | HFTKSPLFSQYTOD-BYYHNAKLSA-N |
| XLogP | 7.19 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide?
The IUPAC name of N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide (CID 134928838) is N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide.
What is the SMILES notation for N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide?
The canonical SMILES for N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide is Cc1ccccc1/N=C(\Cc1ccccc1)N=S(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide?
The InChIKey is HFTKSPLFSQYTOD-BYYHNAKLSA-N. The full InChI is InChI=1S/C27H24N2S/c1-22-13-11-12-20-26(22)28-27(21-23-14-5-2-6-15-23)29-30(24-16-7-3-8-17-24)25-18-9-4-10-19-25/h2-20H,21H2,1H3/b28-27+.
What are the key properties of N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide?
N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide has a molecular weight of 408.57 g/mol, XLogP of 7.19, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diphenyl-λ4-sulfanylidene)-N'-(2-methylphenyl)-2-phenylethanimidamide is sourced from PubChem (CID 134928838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).