About butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine
butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine (PubChem CID 143802806) has the molecular formula C26H31N
and a molecular weight of 357.54 g/mol. Its IUPAC name is butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine.
Molecular Properties
| Compound Name | butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine |
| PubChem CID | 143802806 |
| Molecular Formula | C26H31N |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine |
| SMILES | C/C(=N\c1ccccc1C)c1ccc(C)cc1.CCCCc1ccccc1 |
| InChI | InChI=1S/C16H17N.C10H14/c1-12-8-10-15(11-9-12)14(3)17-16-7-5-4-6-13(16)2;1-2-3-7-10-8-5-4-6-9-10/h4-11H,1-3H3;4-6,8-9H,2-3,7H2,1H3/b17-14+; |
| InChIKey | BQJBHTXSZXXMRZ-KLSJZZFUSA-N |
| XLogP | 7.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine?
The IUPAC name of butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine (CID 143802806) is butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine.
What is the SMILES notation for butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine?
The canonical SMILES for butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine is C/C(=N\c1ccccc1C)c1ccc(C)cc1.CCCCc1ccccc1.
What is the InChIKey of butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine?
The InChIKey is BQJBHTXSZXXMRZ-KLSJZZFUSA-N. The full InChI is InChI=1S/C16H17N.C10H14/c1-12-8-10-15(11-9-12)14(3)17-16-7-5-4-6-13(16)2;1-2-3-7-10-8-5-4-6-9-10/h4-11H,1-3H3;4-6,8-9H,2-3,7H2,1H3/b17-14+;.
What are the key properties of butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine?
butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine has a molecular weight of 357.54 g/mol, XLogP of 7.47, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butylbenzene;N-(2-methylphenyl)-1-(4-methylphenyl)ethanimine is sourced from PubChem (CID 143802806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).