C25H29N — CID 144892248
(3E,5Z)-3,8-dimethyl-7-methylidene-N-phenylnona-3,5,8-trien-2-imine;toluene (PubChem CID 144892248) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol. Its IUPAC name is (3E,5Z)-3,8-dimethyl-7-methylidene-N-phenylnona-3,5,8-trien-2-imine;toluene.
| Compound Name | (3E,5Z)-3,8-dimethyl-7-methylidene-N-phenylnona-3,5,8-trien-2-imine;toluene |
|---|---|
| PubChem CID | 144892248 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (3E,5Z)-3,8-dimethyl-7-methylidene-N-phenylnona-3,5,8-trien-2-imine;toluene |
| SMILES | C=C(C)C(=C)/C=C\C=C(C)\C(C)=N\c1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C18H21N.C7H8/c1-14(2)15(3)10-9-11-16(4)17(5)19-18-12-7-6-8-13-18;1-7-5-3-2-4-6-7/h6-13H,1,3H2,2,4-5H3;2-6H,1H3/b10-9-,16-11+,19-17+; |
| InChIKey | ROGBDRYEFXUBNC-LQDAMKECSA-N |
| XLogP | 7.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|