C28H24Cl2N2Ni — CID 140654060
2-N,3-N-bis(4-phenylphenyl)butane-2,3-diimine;dichloronickel (PubChem CID 140654060) has the molecular formula C28H24Cl2N2Ni and a molecular weight of 518.11 g/mol. Its IUPAC name is 2-N,3-N-bis(4-phenylphenyl)butane-2,3-diimine;dichloronickel.
| Compound Name | 2-N,3-N-bis(4-phenylphenyl)butane-2,3-diimine;dichloronickel |
|---|---|
| PubChem CID | 140654060 |
| Molecular Formula | C28H24Cl2N2Ni |
| Molecular Weight | 518.11 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 2-N,3-N-bis(4-phenylphenyl)butane-2,3-diimine;dichloronickel |
| SMILES | CC(=N\c1ccc(-c2ccccc2)cc1)/C(C)=N/c1ccc(-c2ccccc2)cc1.Cl[Ni]Cl |
| InChI | InChI=1S/C28H24N2.2ClH.Ni/c1-21(29-27-17-13-25(14-18-27)23-9-5-3-6-10-23)22(2)30-28-19-15-26(16-20-28)24-11-7-4-8-12-24;;;/h3-20H,1-2H3;2*1H;/q;;;+2/p-2/b29-21+,30-22+;;; |
| InChIKey | HAGGLLPIWZITNG-GGVBBUNRSA-L |
| XLogP | 9.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.11 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|