C31H31Cl2FeN3 — CID 18719236
1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)-1-methylpyrrol-2-yl]-N-(2,6-dimethylcyclohexa-1,3-dien-1-yl)ethanimine;dichloroiron (PubChem CID 18719236) has the molecular formula C31H31Cl2FeN3 and a molecular weight of 572.36 g/mol. Its IUPAC name is 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)-1-methylpyrrol-2-yl]-N-(2,6-dimethylcyclohexa-1,3-dien-1-yl)ethanimine;dichloroiron.
| Compound Name | 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)-1-methylpyrrol-2-yl]-N-(2,6-dimethylcyclohexa-1,3-dien-1-yl)ethanimine;dichloroiron |
|---|---|
| PubChem CID | 18719236 |
| Molecular Formula | C31H31Cl2FeN3 |
| Molecular Weight | 572.36 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 1-[5-(N-anthracen-9-yl-C-methylcarbonimidoyl)-1-methylpyrrol-2-yl]-N-(2,6-dimethylcyclohexa-1,3-dien-1-yl)ethanimine;dichloroiron |
| SMILES | CC1=C(/N=C(\C)c2ccc(/C(C)=N/c3c4ccccc4cc4ccccc34)n2C)C(C)CC=C1.Cl[Fe]Cl |
| InChI | InChI=1S/C31H31N3.2ClH.Fe/c1-20-11-10-12-21(2)30(20)32-22(3)28-17-18-29(34(28)5)23(4)33-31-26-15-8-6-13-24(26)19-25-14-7-9-16-27(25)31;;;/h6-11,13-19,21H,12H2,1-5H3;2*1H;/q;;;+2/p-2/b32-22+,33-23+;;; |
| InChIKey | RWMWPBZXNVXGOD-YBWNPHJNSA-L |
| XLogP | 9.53 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.36 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|