C21H31Cl2FeN4OP — CID 20702141
dichloroiron;N-[dimethylamino-[(E)-1-[5-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]furan-2-yl]ethylideneamino]phosphanyl]-N-methylmethanamine (PubChem CID 20702141) has the molecular formula C21H31Cl2FeN4OP and a molecular weight of 513.23 g/mol. Its IUPAC name is dichloroiron;N-[dimethylamino-[(E)-1-[5-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]furan-2-yl]ethylideneamino]phosphanyl]-N-methylmethanamine.
| Compound Name | dichloroiron;N-[dimethylamino-[(E)-1-[5-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]furan-2-yl]ethylideneamino]phosphanyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 20702141 |
| Molecular Formula | C21H31Cl2FeN4OP |
| Molecular Weight | 513.23 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | dichloroiron;N-[dimethylamino-[(E)-1-[5-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]furan-2-yl]ethylideneamino]phosphanyl]-N-methylmethanamine |
| SMILES | C/C(=N\c1c(C)cc(C)cc1C)c1ccc(/C(C)=N/P(N(C)C)N(C)C)o1.Cl[Fe]Cl |
| InChI | InChI=1S/C21H31N4OP.2ClH.Fe/c1-14-12-15(2)21(16(3)13-14)22-17(4)19-10-11-20(26-19)18(5)23-27(24(6)7)25(8)9;;;/h10-13H,1-9H3;2*1H;/q;;;+2/p-2/b22-17+,23-18+;;; |
| InChIKey | SAMZFGIAGZGLFF-MVTFOQRWSA-L |
| XLogP | 6.88 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.23 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|