C15H17NO2 — CID 10847816
(NE)-N-[1-[5-(2,4,6-trimethylphenyl)furan-2-yl]ethylidene]hydroxylamine (PubChem CID 10847816) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (NE)-N-[1-[5-(2,4,6-trimethylphenyl)furan-2-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[5-(2,4,6-trimethylphenyl)furan-2-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 10847816 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (NE)-N-[1-[5-(2,4,6-trimethylphenyl)furan-2-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1ccc(-c2c(C)cc(C)cc2C)o1 |
| InChI | InChI=1S/C15H17NO2/c1-9-7-10(2)15(11(3)8-9)14-6-5-13(18-14)12(4)16-17/h5-8,17H,1-4H3/b16-12+ |
| InChIKey | QHZKAOZKBZHPCS-FOWTUZBSSA-N |
| XLogP | 4.07 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|