C21H21NO2 — CID 54586462
N,5-bis(2,6-dimethylphenyl)furan-2-carboxamide (PubChem CID 54586462) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is N,5-bis(2,6-dimethylphenyl)furan-2-carboxamide.
| Compound Name | N,5-bis(2,6-dimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 54586462 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N,5-bis(2,6-dimethylphenyl)furan-2-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccc(-c2c(C)cccc2C)o1 |
| InChI | InChI=1S/C21H21NO2/c1-13-7-5-8-14(2)19(13)17-11-12-18(24-17)21(23)22-20-15(3)9-6-10-16(20)4/h5-12H,1-4H3,(H,22,23) |
| InChIKey | JNXQDWUMFRHMFE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |