C24H27NO3 — CID 21047425
N-(2-hydroxy-6-methylphenyl)-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide (PubChem CID 21047425) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is N-(2-hydroxy-6-methylphenyl)-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-(2-hydroxy-6-methylphenyl)-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047425 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-(2-hydroxy-6-methylphenyl)-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide |
| SMILES | Cc1cccc(O)c1NC(=O)c1ccc(Cc2c(C)c(C)c(C)c(C)c2C)o1 |
| InChI | InChI=1S/C24H27NO3/c1-13-8-7-9-21(26)23(13)25-24(27)22-11-10-19(28-22)12-20-17(5)15(3)14(2)16(4)18(20)6/h7-11,26H,12H2,1-6H3,(H,25,27) |
| InChIKey | KLOWJDYLKBNOOJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|