C22H23NO3 — CID 21047427
N-(2-hydroxy-6-methylphenyl)-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide (PubChem CID 21047427) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-(2-hydroxy-6-methylphenyl)-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-(2-hydroxy-6-methylphenyl)-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047427 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-(2-hydroxy-6-methylphenyl)-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)c(Cc2ccc(C(=O)Nc3c(C)cccc3O)o2)c(C)c1 |
| InChI | InChI=1S/C22H23NO3/c1-13-10-15(3)18(16(4)11-13)12-17-8-9-20(26-17)22(25)23-21-14(2)6-5-7-19(21)24/h5-11,24H,12H2,1-4H3,(H,23,25) |
| InChIKey | MHDPFWRODDPWGU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|