C25H30N2O4S — CID 21047643
N-[3-(butylsulfamoyl)phenyl]-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide (PubChem CID 21047643) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047643 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)c2ccc(Cc3c(C)cc(C)cc3C)o2)c1 |
| InChI | InChI=1S/C25H30N2O4S/c1-5-6-12-26-32(29,30)22-9-7-8-20(15-22)27-25(28)24-11-10-21(31-24)16-23-18(3)13-17(2)14-19(23)4/h7-11,13-15,26H,5-6,12,16H2,1-4H3,(H,27,28) |
| InChIKey | XCQHQGNHVLNWTK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|