C14H14N2O6S — CID 138042642
2-[[3-[(5-methylfuran-2-carbonyl)amino]phenyl]sulfonylamino]acetic acid (PubChem CID 138042642) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-[[3-[(5-methylfuran-2-carbonyl)amino]phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[3-[(5-methylfuran-2-carbonyl)amino]phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 138042642 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-[[3-[(5-methylfuran-2-carbonyl)amino]phenyl]sulfonylamino]acetic acid |
| SMILES | Cc1ccc(C(=O)Nc2cccc(S(=O)(=O)NCC(=O)O)c2)o1 |
| InChI | InChI=1S/C14H14N2O6S/c1-9-5-6-12(22-9)14(19)16-10-3-2-4-11(7-10)23(20,21)15-8-13(17)18/h2-7,15H,8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | STJMKPPCNDCLCB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |