C14H16F2N2O5S — CID 167864572
2-[[3-[[1-(difluoromethyl)cyclobutanecarbonyl]amino]phenyl]sulfonylamino]acetic acid (PubChem CID 167864572) has the molecular formula C14H16F2N2O5S and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-[[3-[[1-(difluoromethyl)cyclobutanecarbonyl]amino]phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[3-[[1-(difluoromethyl)cyclobutanecarbonyl]amino]phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 167864572 |
| Molecular Formula | C14H16F2N2O5S |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-[[3-[[1-(difluoromethyl)cyclobutanecarbonyl]amino]phenyl]sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1cccc(NC(=O)C2(C(F)F)CCC2)c1 |
| InChI | InChI=1S/C14H16F2N2O5S/c15-12(16)14(5-2-6-14)13(21)18-9-3-1-4-10(7-9)24(22,23)17-8-11(19)20/h1,3-4,7,12,17H,2,5-6,8H2,(H,18,21)(H,19,20) |
| InChIKey | BKAVYGWRFAUHIE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |