C24H21N3O4 — CID 21048231
N-(6-nitroquinolin-5-yl)-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide (PubChem CID 21048231) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-(6-nitroquinolin-5-yl)-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-(6-nitroquinolin-5-yl)-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21048231 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-(6-nitroquinolin-5-yl)-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)c(Cc2ccc(C(=O)Nc3c([N+](=O)[O-])ccc4ncccc34)o2)c(C)c1 |
| InChI | InChI=1S/C24H21N3O4/c1-14-11-15(2)19(16(3)12-14)13-17-6-9-22(31-17)24(28)26-23-18-5-4-10-25-20(18)7-8-21(23)27(29)30/h4-12H,13H2,1-3H3,(H,26,28) |
| InChIKey | RNCPSXHTMHEGRI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|