C31H32N2O2 — CID 21047779
N-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide (PubChem CID 21047779) has the molecular formula C31H32N2O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047779 |
| Molecular Formula | C31H32N2O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | N-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-5-[(2,4,6-trimethylphenyl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)c(Cc2ccc(C(=O)Nc3ccc(/C=C/c4ccc(N(C)C)cc4)cc3)o2)c(C)c1 |
| InChI | InChI=1S/C31H32N2O2/c1-21-18-22(2)29(23(3)19-21)20-28-16-17-30(35-28)31(34)32-26-12-8-24(9-13-26)6-7-25-10-14-27(15-11-25)33(4)5/h6-19H,20H2,1-5H3,(H,32,34)/b7-6+ |
| InChIKey | UJFBBMQXPUVFTO-VOTSOKGWSA-N |
| XLogP | 7.28 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|