C27H34N2O2 — CID 21047933
N-[4-(diethylamino)phenyl]-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide (PubChem CID 21047933) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047933 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc(Cc3c(C)c(C)c(C)c(C)c3C)o2)cc1 |
| InChI | InChI=1S/C27H34N2O2/c1-8-29(9-2)23-12-10-22(11-13-23)28-27(30)26-15-14-24(31-26)16-25-20(6)18(4)17(3)19(5)21(25)7/h10-15H,8-9,16H2,1-7H3,(H,28,30) |
| InChIKey | JFXFLOICMAHCSF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|