C22H27N3O2S2 — CID 21045903
5-[(2,3,4,5,6-pentamethylphenyl)methyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide (PubChem CID 21045903) has the molecular formula C22H27N3O2S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is 5-[(2,3,4,5,6-pentamethylphenyl)methyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-[(2,3,4,5,6-pentamethylphenyl)methyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21045903 |
| Molecular Formula | C22H27N3O2S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 5-[(2,3,4,5,6-pentamethylphenyl)methyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
| SMILES | CCCSc1nnc(NC(=O)c2ccc(Cc3c(C)c(C)c(C)c(C)c3C)o2)s1 |
| InChI | InChI=1S/C22H27N3O2S2/c1-7-10-28-22-25-24-21(29-22)23-20(26)19-9-8-17(27-19)11-18-15(5)13(3)12(2)14(4)16(18)6/h8-9H,7,10-11H2,1-6H3,(H,23,24,26) |
| InChIKey | OJRWCNXBZMEHCP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|