C14H16N2O2 — CID 82344274
5-amino-N-(2,4,6-trimethylphenyl)furan-2-carboxamide (PubChem CID 82344274) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-amino-N-(2,4,6-trimethylphenyl)furan-2-carboxamide.
| Compound Name | 5-amino-N-(2,4,6-trimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82344274 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 5-amino-N-(2,4,6-trimethylphenyl)furan-2-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(N)o2)c(C)c1 |
| InChI | InChI=1S/C14H16N2O2/c1-8-6-9(2)13(10(3)7-8)16-14(17)11-4-5-12(15)18-11/h4-7H,15H2,1-3H3,(H,16,17) |
| InChIKey | QKXBQTXFCWWBSF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |