C12H8F2O3 — CID 82820130
5-(2,6-difluoro-3-methylphenyl)furan-2-carboxylic acid (PubChem CID 82820130) has the molecular formula C12H8F2O3 and a molecular weight of 238.19 g/mol. Its IUPAC name is 5-(2,6-difluoro-3-methylphenyl)furan-2-carboxylic acid.
| Compound Name | 5-(2,6-difluoro-3-methylphenyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 82820130 |
| Molecular Formula | C12H8F2O3 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 5-(2,6-difluoro-3-methylphenyl)furan-2-carboxylic acid |
| SMILES | Cc1ccc(F)c(-c2ccc(C(=O)O)o2)c1F |
| InChI | InChI=1S/C12H8F2O3/c1-6-2-3-7(13)10(11(6)14)8-4-5-9(17-8)12(15)16/h2-5H,1H3,(H,15,16) |
| InChIKey | BJVGIAJHCFQWRX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |