C16H18O3 — CID 63424237
5-(2,3,4,5,6-pentamethylphenyl)furan-2-carboxylic acid (PubChem CID 63424237) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentamethylphenyl)furan-2-carboxylic acid.
| Compound Name | 5-(2,3,4,5,6-pentamethylphenyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63424237 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 5-(2,3,4,5,6-pentamethylphenyl)furan-2-carboxylic acid |
| SMILES | Cc1c(C)c(C)c(-c2ccc(C(=O)O)o2)c(C)c1C |
| InChI | InChI=1S/C16H18O3/c1-8-9(2)11(4)15(12(5)10(8)3)13-6-7-14(19-13)16(17)18/h6-7H,1-5H3,(H,17,18) |
| InChIKey | PDIPDEMPKAYEJA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |