C26H32Cl2FeN4 — CID 140654192
dichloroiron;1-[1-methyl-2-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]imidazol-4-yl]-N-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 140654192) has the molecular formula C26H32Cl2FeN4 and a molecular weight of 527.32 g/mol. Its IUPAC name is dichloroiron;1-[1-methyl-2-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]imidazol-4-yl]-N-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | dichloroiron;1-[1-methyl-2-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]imidazol-4-yl]-N-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 140654192 |
| Molecular Formula | C26H32Cl2FeN4 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | dichloroiron;1-[1-methyl-2-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]imidazol-4-yl]-N-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | C/C(=N\c1c(C)cc(C)cc1C)c1cn(C)c(/C(C)=N/c2c(C)cc(C)cc2C)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C26H32N4.2ClH.Fe/c1-15-10-17(3)24(18(4)11-15)27-21(7)23-14-30(9)26(29-23)22(8)28-25-19(5)12-16(2)13-20(25)6;;;/h10-14H,1-9H3;2*1H;/q;;;+2/p-2/b27-21+,28-22+;;; |
| InChIKey | UUQFDVPNWMYSHO-GBJOXJENSA-L |
| XLogP | 7.93 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|