C24H25N — CID 589790
1,1-diphenyl-N-[1-(2,4,6-trimethylphenyl)ethyl]methanimine (PubChem CID 589790) has the molecular formula C24H25N and a molecular weight of 327.47 g/mol. Its IUPAC name is 1,1-diphenyl-N-[1-(2,4,6-trimethylphenyl)ethyl]methanimine.
| Compound Name | 1,1-diphenyl-N-[1-(2,4,6-trimethylphenyl)ethyl]methanimine |
|---|---|
| PubChem CID | 589790 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1,1-diphenyl-N-[1-(2,4,6-trimethylphenyl)ethyl]methanimine |
| SMILES | Cc1cc(C)c(C(C)N=C(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H25N/c1-17-15-18(2)23(19(3)16-17)20(4)25-24(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-16,20H,1-4H3 |
| InChIKey | LZDXUQBIBLPCLP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|